C34H61N8O13P — CID 126761995
[4-[[4-[(2R)-3-[2-(2-aminooxyethoxy)ethylamino]-2-[bis[2-[2-(2-aminooxyethoxy)ethylamino]-2-oxoethyl]amino]-3-oxopropyl]phenyl]methylcarbamoyl]cyclohexyl]oxy-methylphosphinic acid (PubChem CID 126761995) has the molecular formula C34H61N8O13P and a molecular weight of 820.88 g/mol. Its IUPAC name is [4-[[4-[(2R)-3-[2-(2-aminooxyethoxy)ethylamino]-2-[bis[2-[2-(2-aminooxyethoxy)ethylamino]-2-oxoethyl]amino]-3-oxopropyl]phenyl]methylcarbamoyl]cyclohexyl]oxy-methylphosphinic acid.
| Compound Name | [4-[[4-[(2R)-3-[2-(2-aminooxyethoxy)ethylamino]-2-[bis[2-[2-(2-aminooxyethoxy)ethylamino]-2-oxoethyl]amino]-3-oxopropyl]phenyl]methylcarbamoyl]cyclohexyl]oxy-methylphosphinic acid |
|---|---|
| PubChem CID | 126761995 |
| Molecular Formula | C34H61N8O13P |
| Molecular Weight | 820.88 g/mol |
| Exact Mass | 820.41 |
| IUPAC Name | [4-[[4-[(2R)-3-[2-(2-aminooxyethoxy)ethylamino]-2-[bis[2-[2-(2-aminooxyethoxy)ethylamino]-2-oxoethyl]amino]-3-oxopropyl]phenyl]methylcarbamoyl]cyclohexyl]oxy-methylphosphinic acid |
| SMILES | CP(=O)(O)OC1CCC(C(=O)NCc2ccc(C[C@H](C(=O)NCCOCCON)N(CC(=O)NCCOCCON)CC(=O)NCCOCCON)cc2)CC1 |
| InChI | InChI=1S/C34H61N8O13P/c1-56(47,48)55-29-8-6-28(7-9-29)33(45)41-23-27-4-2-26(3-5-27)22-30(34(46)40-12-15-51-18-21-54-37)42(24-31(43)38-10-13-49-16-19-52-35)25-32(44)39-11-14-50-17-20-53-36/h2-5,28-30H,6-25,35-37H2,1H3,(H,38,43)(H,39,44)(H,40,46)(H,41,45)(H,47,48)/t28?,29?,30-/m1/s1 |
| InChIKey | VDGIIZLRAYVQSF-QGVFFIPKSA-N |
| XLogP | -2.02 |
| TPSA | 299.61 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 820.88 |
| LogP ≤ 5 | -2.02 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|