C27H50N7O12P — CID 166980177
[4-[3-[2-(2-aminooxyethoxy)ethylamino]-2-[bis[2-[2-(2-aminooxyethoxy)ethylamino]-2-oxoethyl]amino]-3-oxopropyl]phenoxy]-ethylphosphinic acid (PubChem CID 166980177) has the molecular formula C27H50N7O12P and a molecular weight of 695.71 g/mol. Its IUPAC name is [4-[3-[2-(2-aminooxyethoxy)ethylamino]-2-[bis[2-[2-(2-aminooxyethoxy)ethylamino]-2-oxoethyl]amino]-3-oxopropyl]phenoxy]-ethylphosphinic acid.
| Compound Name | [4-[3-[2-(2-aminooxyethoxy)ethylamino]-2-[bis[2-[2-(2-aminooxyethoxy)ethylamino]-2-oxoethyl]amino]-3-oxopropyl]phenoxy]-ethylphosphinic acid |
|---|---|
| PubChem CID | 166980177 |
| Molecular Formula | C27H50N7O12P |
| Molecular Weight | 695.71 g/mol |
| Exact Mass | 695.33 |
| IUPAC Name | [4-[3-[2-(2-aminooxyethoxy)ethylamino]-2-[bis[2-[2-(2-aminooxyethoxy)ethylamino]-2-oxoethyl]amino]-3-oxopropyl]phenoxy]-ethylphosphinic acid |
| SMILES | CCP(=O)(O)Oc1ccc(CC(C(=O)NCCOCCON)N(CC(=O)NCCOCCON)CC(=O)NCCOCCON)cc1 |
| InChI | InChI=1S/C27H50N7O12P/c1-2-47(38,39)46-23-5-3-22(4-6-23)19-24(27(37)33-9-12-42-15-18-45-30)34(20-25(35)31-7-10-40-13-16-43-28)21-26(36)32-8-11-41-14-17-44-29/h3-6,24H,2,7-21,28-30H2,1H3,(H,31,35)(H,32,36)(H,33,37)(H,38,39) |
| InChIKey | IYKFLQAKIHXLAL-UHFFFAOYSA-N |
| XLogP | -2.45 |
| TPSA | 270.51 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.71 |
| LogP ≤ 5 | -2.45 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|