C39H62N5O16P — CID 130340548
[4-[[4-[3-[2-(2-acetyloxyethoxy)ethylamino]-2-[bis[2-[2-(2-acetyloxyethoxy)ethylamino]-2-oxoethyl]amino]-3-oxopropyl]phenyl]carbamoyl]cyclohexyl]oxy-methylphosphinic acid (PubChem CID 130340548) has the molecular formula C39H62N5O16P and a molecular weight of 887.92 g/mol. Its IUPAC name is [4-[[4-[3-[2-(2-acetyloxyethoxy)ethylamino]-2-[bis[2-[2-(2-acetyloxyethoxy)ethylamino]-2-oxoethyl]amino]-3-oxopropyl]phenyl]carbamoyl]cyclohexyl]oxy-methylphosphinic acid.
| Compound Name | [4-[[4-[3-[2-(2-acetyloxyethoxy)ethylamino]-2-[bis[2-[2-(2-acetyloxyethoxy)ethylamino]-2-oxoethyl]amino]-3-oxopropyl]phenyl]carbamoyl]cyclohexyl]oxy-methylphosphinic acid |
|---|---|
| PubChem CID | 130340548 |
| Molecular Formula | C39H62N5O16P |
| Molecular Weight | 887.92 g/mol |
| Exact Mass | 887.39 |
| IUPAC Name | [4-[[4-[3-[2-(2-acetyloxyethoxy)ethylamino]-2-[bis[2-[2-(2-acetyloxyethoxy)ethylamino]-2-oxoethyl]amino]-3-oxopropyl]phenyl]carbamoyl]cyclohexyl]oxy-methylphosphinic acid |
| SMILES | CC(=O)OCCOCCNC(=O)CN(CC(=O)NCCOCCOC(C)=O)C(Cc1ccc(NC(=O)C2CCC(OP(C)(=O)O)CC2)cc1)C(=O)NCCOCCOC(C)=O |
| InChI | InChI=1S/C39H62N5O16P/c1-28(45)57-22-19-54-16-13-40-36(48)26-44(27-37(49)41-14-17-55-20-23-58-29(2)46)35(39(51)42-15-18-56-21-24-59-30(3)47)25-31-5-9-33(10-6-31)43-38(50)32-7-11-34(12-8-32)60-61(4,52)53/h5-6,9-10,32,34-35H,7-8,11-27H2,1-4H3,(H,40,48)(H,41,49)(H,42,51)(H,43,50)(H,52,53) |
| InChIKey | ABGSPGURKZIJQW-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 272.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 887.92 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|