C26H45N5O6S2 — CID 144543533
6-[3-[3-(4-iminopentylsulfanyl)-2,5-dioxopyrrolidin-1-yl]propanoylamino]-2-[[4-methyl-4-(methylsulfanylmethoxy)pentanoyl]amino]hexanamide (PubChem CID 144543533) has the molecular formula C26H45N5O6S2 and a molecular weight of 587.81 g/mol. Its IUPAC name is 6-[3-[3-(4-iminopentylsulfanyl)-2,5-dioxopyrrolidin-1-yl]propanoylamino]-2-[[4-methyl-4-(methylsulfanylmethoxy)pentanoyl]amino]hexanamide.
| Compound Name | 6-[3-[3-(4-iminopentylsulfanyl)-2,5-dioxopyrrolidin-1-yl]propanoylamino]-2-[[4-methyl-4-(methylsulfanylmethoxy)pentanoyl]amino]hexanamide |
|---|---|
| PubChem CID | 144543533 |
| Molecular Formula | C26H45N5O6S2 |
| Molecular Weight | 587.81 g/mol |
| Exact Mass | 587.28 |
| IUPAC Name | 6-[3-[3-(4-iminopentylsulfanyl)-2,5-dioxopyrrolidin-1-yl]propanoylamino]-2-[[4-methyl-4-(methylsulfanylmethoxy)pentanoyl]amino]hexanamide |
| SMILES | [H]/N=C(\C)CCCSC1CC(=O)N(CCC(=O)NCCCCC(NC(=O)CCC(C)(C)OCSC)C(N)=O)C1=O |
| InChI | InChI=1S/C26H45N5O6S2/c1-18(27)8-7-15-39-20-16-23(34)31(25(20)36)14-11-21(32)29-13-6-5-9-19(24(28)35)30-22(33)10-12-26(2,3)37-17-38-4/h19-20,27H,5-17H2,1-4H3,(H2,28,35)(H,29,32)(H,30,33)/b27-18+ |
| InChIKey | HPTDEHOHFBSRFE-OVVQPSECSA-N |
| XLogP | 2.21 |
| TPSA | 171.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.81 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|