C16H26N2O4S2 — CID 158664345
methanethiol;3-methylsulfanyl-1-propylpyrrolidine-2,5-dione;1-propylpyrrole-2,5-dione (PubChem CID 158664345) has the molecular formula C16H26N2O4S2 and a molecular weight of 374.53 g/mol. Its IUPAC name is methanethiol;3-methylsulfanyl-1-propylpyrrolidine-2,5-dione;1-propylpyrrole-2,5-dione.
| Compound Name | methanethiol;3-methylsulfanyl-1-propylpyrrolidine-2,5-dione;1-propylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 158664345 |
| Molecular Formula | C16H26N2O4S2 |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | methanethiol;3-methylsulfanyl-1-propylpyrrolidine-2,5-dione;1-propylpyrrole-2,5-dione |
| SMILES | CCCN1C(=O)C=CC1=O.CCCN1C(=O)CC(SC)C1=O.CS |
| InChI | InChI=1S/C8H13NO2S.C7H9NO2.CH4S/c1-3-4-9-7(10)5-6(12-2)8(9)11;1-2-5-8-6(9)3-4-7(8)10;1-2/h6H,3-5H2,1-2H3;3-4H,2,5H2,1H3;2H,1H3 |
| InChIKey | IDDWMLGIASGSFO-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 74.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|