C18H30N2O4S2 — CID 158574620
methanethiol;1-(2-methylpropyl)-3-methylsulfanylpyrrolidine-2,5-dione;1-(2-methylpropyl)pyrrole-2,5-dione (PubChem CID 158574620) has the molecular formula C18H30N2O4S2 and a molecular weight of 402.58 g/mol. Its IUPAC name is methanethiol;1-(2-methylpropyl)-3-methylsulfanylpyrrolidine-2,5-dione;1-(2-methylpropyl)pyrrole-2,5-dione.
| Compound Name | methanethiol;1-(2-methylpropyl)-3-methylsulfanylpyrrolidine-2,5-dione;1-(2-methylpropyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 158574620 |
| Molecular Formula | C18H30N2O4S2 |
| Molecular Weight | 402.58 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | methanethiol;1-(2-methylpropyl)-3-methylsulfanylpyrrolidine-2,5-dione;1-(2-methylpropyl)pyrrole-2,5-dione |
| SMILES | CC(C)CN1C(=O)C=CC1=O.CS.CSC1CC(=O)N(CC(C)C)C1=O |
| InChI | InChI=1S/C9H15NO2S.C8H11NO2.CH4S/c1-6(2)5-10-8(11)4-7(13-3)9(10)12;1-6(2)5-9-7(10)3-4-8(9)11;1-2/h6-7H,4-5H2,1-3H3;3-4,6H,5H2,1-2H3;2H,1H3 |
| InChIKey | HSMVTWKOXFGWMM-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 74.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.58 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|