About 3-(4,6-diaminopyrimidin-2-yl)sulfanyl-1-propylpyrrolidine-2,5-dione
3-(4,6-diaminopyrimidin-2-yl)sulfanyl-1-propylpyrrolidine-2,5-dione (PubChem CID 61296236) has the molecular formula C11H15N5O2S
and a molecular weight of 281.34 g/mol. Its IUPAC name is 3-(4,6-diaminopyrimidin-2-yl)sulfanyl-1-propylpyrrolidine-2,5-dione.
Molecular Properties
| Compound Name | 3-(4,6-diaminopyrimidin-2-yl)sulfanyl-1-propylpyrrolidine-2,5-dione |
| PubChem CID | 61296236 |
| Molecular Formula | C11H15N5O2S |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | 3-(4,6-diaminopyrimidin-2-yl)sulfanyl-1-propylpyrrolidine-2,5-dione |
| SMILES | CCCN1C(=O)CC(Sc2nc(N)cc(N)n2)C1=O |
| InChI | InChI=1S/C11H15N5O2S/c1-2-3-16-9(17)4-6(10(16)18)19-11-14-7(12)5-8(13)15-11/h5-6H,2-4H2,1H3,(H4,12,13,14,15) |
| InChIKey | SAUHGDUQMYAPSL-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 115.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-(4,6-diaminopyrimidin-2-yl)sulfanyl-1-propylpyrrolidine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4,6-diaminopyrimidin-2-yl)sulfanyl-1-propylpyrrolidine-2,5-dione?
The IUPAC name of 3-(4,6-diaminopyrimidin-2-yl)sulfanyl-1-propylpyrrolidine-2,5-dione (CID 61296236) is 3-(4,6-diaminopyrimidin-2-yl)sulfanyl-1-propylpyrrolidine-2,5-dione.
What is the SMILES notation for 3-(4,6-diaminopyrimidin-2-yl)sulfanyl-1-propylpyrrolidine-2,5-dione?
The canonical SMILES for 3-(4,6-diaminopyrimidin-2-yl)sulfanyl-1-propylpyrrolidine-2,5-dione is CCCN1C(=O)CC(Sc2nc(N)cc(N)n2)C1=O.
What is the InChIKey of 3-(4,6-diaminopyrimidin-2-yl)sulfanyl-1-propylpyrrolidine-2,5-dione?
The InChIKey is SAUHGDUQMYAPSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N5O2S/c1-2-3-16-9(17)4-6(10(16)18)19-11-14-7(12)5-8(13)15-11/h5-6H,2-4H2,1H3,(H4,12,13,14,15).
What are the key properties of 3-(4,6-diaminopyrimidin-2-yl)sulfanyl-1-propylpyrrolidine-2,5-dione?
3-(4,6-diaminopyrimidin-2-yl)sulfanyl-1-propylpyrrolidine-2,5-dione has a molecular weight of 281.34 g/mol, XLogP of 0.27, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4,6-diaminopyrimidin-2-yl)sulfanyl-1-propylpyrrolidine-2,5-dione is sourced from PubChem (CID 61296236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).