C8H9N5O2S — CID 61296048
3-(4,6-diaminopyrimidin-2-yl)sulfanylpyrrolidine-2,5-dione (PubChem CID 61296048) has the molecular formula C8H9N5O2S and a molecular weight of 239.26 g/mol. Its IUPAC name is 3-(4,6-diaminopyrimidin-2-yl)sulfanylpyrrolidine-2,5-dione.
| Compound Name | 3-(4,6-diaminopyrimidin-2-yl)sulfanylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 61296048 |
| Molecular Formula | C8H9N5O2S |
| Molecular Weight | 239.26 g/mol |
| Exact Mass | 239.05 |
| IUPAC Name | 3-(4,6-diaminopyrimidin-2-yl)sulfanylpyrrolidine-2,5-dione |
| SMILES | Nc1cc(N)nc(SC2CC(=O)NC2=O)n1 |
| InChI | InChI=1S/C8H9N5O2S/c9-4-2-5(10)12-8(11-4)16-3-1-6(14)13-7(3)15/h2-3H,1H2,(H,13,14,15)(H4,9,10,11,12) |
| InChIKey | WMJYNRJCGSLKTE-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 123.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.26 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|