C10H15N5OS — CID 63887696
4-(4,6-diaminopyrimidin-2-yl)sulfanylazepan-2-one (PubChem CID 63887696) has the molecular formula C10H15N5OS and a molecular weight of 253.33 g/mol. Its IUPAC name is 4-(4,6-diaminopyrimidin-2-yl)sulfanylazepan-2-one.
| Compound Name | 4-(4,6-diaminopyrimidin-2-yl)sulfanylazepan-2-one |
|---|---|
| PubChem CID | 63887696 |
| Molecular Formula | C10H15N5OS |
| Molecular Weight | 253.33 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | 4-(4,6-diaminopyrimidin-2-yl)sulfanylazepan-2-one |
| SMILES | Nc1cc(N)nc(SC2CCCNC(=O)C2)n1 |
| InChI | InChI=1S/C10H15N5OS/c11-7-5-8(12)15-10(14-7)17-6-2-1-3-13-9(16)4-6/h5-6H,1-4H2,(H,13,16)(H4,11,12,14,15) |
| InChIKey | BHUXYOBWEGBEGK-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.33 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |