C18H26N4O8S2-2 — CID 158266005
(Z)-2-(methylamino)-3-oxidooxyprop-2-ene-1-thiol;1-methyl-3-[(Z)-2-(methylamino)-3-oxidooxyprop-2-enyl]sulfanylpyrrolidine-2,5-dione;1-methylpyrrole-2,5-dione (PubChem CID 158266005) has the molecular formula C18H26N4O8S2-2 and a molecular weight of 490.56 g/mol. Its IUPAC name is (Z)-2-(methylamino)-3-oxidooxyprop-2-ene-1-thiol;1-methyl-3-[(Z)-2-(methylamino)-3-oxidooxyprop-2-enyl]sulfanylpyrrolidine-2,5-dione;1-methylpyrrole-2,5-dione.
| Compound Name | (Z)-2-(methylamino)-3-oxidooxyprop-2-ene-1-thiol;1-methyl-3-[(Z)-2-(methylamino)-3-oxidooxyprop-2-enyl]sulfanylpyrrolidine-2,5-dione;1-methylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 158266005 |
| Molecular Formula | C18H26N4O8S2-2 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.12 |
| IUPAC Name | (Z)-2-(methylamino)-3-oxidooxyprop-2-ene-1-thiol;1-methyl-3-[(Z)-2-(methylamino)-3-oxidooxyprop-2-enyl]sulfanylpyrrolidine-2,5-dione;1-methylpyrrole-2,5-dione |
| SMILES | CN/C(=C\O[O-])CS.CN/C(=C\O[O-])CSC1CC(=O)N(C)C1=O.CN1C(=O)C=CC1=O |
| InChI | InChI=1S/C9H14N2O4S.C5H5NO2.C4H9NO2S/c1-10-6(4-15-14)5-16-7-3-8(12)11(2)9(7)13;1-6-4(7)2-3-5(6)8;1-5-4(3-8)2-7-6/h4,7,10,14H,3,5H2,1-2H3;2-3H,1H3;2,5-6,8H,3H2,1H3/p-2/b6-4-;;4-2- |
| InChIKey | GILGKYKOPKCYHS-YAYITDBCSA-L |
| XLogP | -2.36 |
| TPSA | 163.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | -2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|