C10H21N — CID 67522864
1,4-diethylazepane (PubChem CID 67522864) has the molecular formula C10H21N and a molecular weight of 155.28 g/mol. Its IUPAC name is 1,4-diethylazepane.
| Compound Name | 1,4-diethylazepane |
|---|---|
| PubChem CID | 67522864 |
| Molecular Formula | C10H21N |
| Molecular Weight | 155.28 g/mol |
| Exact Mass | 155.17 |
| IUPAC Name | 1,4-diethylazepane |
| SMILES | CCC1CCCN(CC)CC1 |
| InChI | InChI=1S/C10H21N/c1-3-10-6-5-8-11(4-2)9-7-10/h10H,3-9H2,1-2H3 |
| InChIKey | DLBCFWJPMGYGRS-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.28 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |