C9H17N3O3S — CID 76926596
N'-hydroxy-2-(1-oxo-1,4-thiazinane-4-carbonyl)butanimidamide (PubChem CID 76926596) has the molecular formula C9H17N3O3S and a molecular weight of 247.32 g/mol. Its IUPAC name is N'-hydroxy-2-(1-oxo-1,4-thiazinane-4-carbonyl)butanimidamide.
| Compound Name | N'-hydroxy-2-(1-oxo-1,4-thiazinane-4-carbonyl)butanimidamide |
|---|---|
| PubChem CID | 76926596 |
| Molecular Formula | C9H17N3O3S |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | N'-hydroxy-2-(1-oxo-1,4-thiazinane-4-carbonyl)butanimidamide |
| SMILES | CCC(C(=O)N1CCS(=O)CC1)C(N)=NO |
| InChI | InChI=1S/C9H17N3O3S/c1-2-7(8(10)11-14)9(13)12-3-5-16(15)6-4-12/h7,14H,2-6H2,1H3,(H2,10,11) |
| InChIKey | YUFGLLMLQNTIOO-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 95.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|