C14H25NO3S — CID 86779212
2-cyclohexyloxy-1-(1-oxo-1,4-thiazinan-4-yl)butan-1-one (PubChem CID 86779212) has the molecular formula C14H25NO3S and a molecular weight of 287.43 g/mol. Its IUPAC name is 2-cyclohexyloxy-1-(1-oxo-1,4-thiazinan-4-yl)butan-1-one.
| Compound Name | 2-cyclohexyloxy-1-(1-oxo-1,4-thiazinan-4-yl)butan-1-one |
|---|---|
| PubChem CID | 86779212 |
| Molecular Formula | C14H25NO3S |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | 2-cyclohexyloxy-1-(1-oxo-1,4-thiazinan-4-yl)butan-1-one |
| SMILES | CCC(OC1CCCCC1)C(=O)N1CCS(=O)CC1 |
| InChI | InChI=1S/C14H25NO3S/c1-2-13(18-12-6-4-3-5-7-12)14(16)15-8-10-19(17)11-9-15/h12-13H,2-11H2,1H3 |
| InChIKey | FSDBHLOWMUHLCB-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |