C18H31NO4 — CID 124684075
3-[(3S)-1-[(2S)-2-cyclohexyloxybutanoyl]piperidin-3-yl]propanoic acid (PubChem CID 124684075) has the molecular formula C18H31NO4 and a molecular weight of 325.45 g/mol. Its IUPAC name is 3-[(3S)-1-[(2S)-2-cyclohexyloxybutanoyl]piperidin-3-yl]propanoic acid.
| Compound Name | 3-[(3S)-1-[(2S)-2-cyclohexyloxybutanoyl]piperidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 124684075 |
| Molecular Formula | C18H31NO4 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.23 |
| IUPAC Name | 3-[(3S)-1-[(2S)-2-cyclohexyloxybutanoyl]piperidin-3-yl]propanoic acid |
| SMILES | CC[C@H](OC1CCCCC1)C(=O)N1CCC[C@@H](CCC(=O)O)C1 |
| InChI | InChI=1S/C18H31NO4/c1-2-16(23-15-8-4-3-5-9-15)18(22)19-12-6-7-14(13-19)10-11-17(20)21/h14-16H,2-13H2,1H3,(H,20,21)/t14-,16-/m0/s1 |
| InChIKey | RQDGBMIWVQBPFC-HOCLYGCPSA-N |
| XLogP | 3.22 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |