C9H18N2O2S — CID 94243526
(2R)-2-amino-1-(1-oxo-1,4-thiazinan-4-yl)pentan-1-one (PubChem CID 94243526) has the molecular formula C9H18N2O2S and a molecular weight of 218.32 g/mol. Its IUPAC name is (2R)-2-amino-1-(1-oxo-1,4-thiazinan-4-yl)pentan-1-one.
| Compound Name | (2R)-2-amino-1-(1-oxo-1,4-thiazinan-4-yl)pentan-1-one |
|---|---|
| PubChem CID | 94243526 |
| Molecular Formula | C9H18N2O2S |
| Molecular Weight | 218.32 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | (2R)-2-amino-1-(1-oxo-1,4-thiazinan-4-yl)pentan-1-one |
| SMILES | CCC[C@@H](N)C(=O)N1CCS(=O)CC1 |
| InChI | InChI=1S/C9H18N2O2S/c1-2-3-8(10)9(12)11-4-6-14(13)7-5-11/h8H,2-7,10H2,1H3/t8-/m1/s1 |
| InChIKey | WPQRMZZNTCFLML-MRVPVSSYSA-N |
| XLogP | -0.30 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.32 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |