C12H24N4O2 — CID 54872852
4-(2-aminopentanoyl)-N,N-dimethylpiperazine-1-carboxamide (PubChem CID 54872852) has the molecular formula C12H24N4O2 and a molecular weight of 256.35 g/mol. Its IUPAC name is 4-(2-aminopentanoyl)-N,N-dimethylpiperazine-1-carboxamide.
| Compound Name | 4-(2-aminopentanoyl)-N,N-dimethylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 54872852 |
| Molecular Formula | C12H24N4O2 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | 4-(2-aminopentanoyl)-N,N-dimethylpiperazine-1-carboxamide |
| SMILES | CCCC(N)C(=O)N1CCN(C(=O)N(C)C)CC1 |
| InChI | InChI=1S/C12H24N4O2/c1-4-5-10(13)11(17)15-6-8-16(9-7-15)12(18)14(2)3/h10H,4-9,13H2,1-3H3 |
| InChIKey | MHELPSBIYGKFSP-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 69.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |