C14H28N4O2 — CID 60937695
2-[4-(2-aminohexanoyl)piperazin-1-yl]-N,N-dimethylacetamide (PubChem CID 60937695) has the molecular formula C14H28N4O2 and a molecular weight of 284.40 g/mol. Its IUPAC name is 2-[4-(2-aminohexanoyl)piperazin-1-yl]-N,N-dimethylacetamide.
| Compound Name | 2-[4-(2-aminohexanoyl)piperazin-1-yl]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 60937695 |
| Molecular Formula | C14H28N4O2 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.22 |
| IUPAC Name | 2-[4-(2-aminohexanoyl)piperazin-1-yl]-N,N-dimethylacetamide |
| SMILES | CCCCC(N)C(=O)N1CCN(CC(=O)N(C)C)CC1 |
| InChI | InChI=1S/C14H28N4O2/c1-4-5-6-12(15)14(20)18-9-7-17(8-10-18)11-13(19)16(2)3/h12H,4-11,15H2,1-3H3 |
| InChIKey | FREUZTXYCWBVDQ-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 69.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |