C13H25N3O — CID 156802102
acetylene;methanol;(Z)-3-(1-piperidin-1-ylethylideneamino)prop-2-en-1-amine (PubChem CID 156802102) has the molecular formula C13H25N3O and a molecular weight of 239.36 g/mol. Its IUPAC name is acetylene;methanol;(Z)-3-(1-piperidin-1-ylethylideneamino)prop-2-en-1-amine.
| Compound Name | acetylene;methanol;(Z)-3-(1-piperidin-1-ylethylideneamino)prop-2-en-1-amine |
|---|---|
| PubChem CID | 156802102 |
| Molecular Formula | C13H25N3O |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.20 |
| IUPAC Name | acetylene;methanol;(Z)-3-(1-piperidin-1-ylethylideneamino)prop-2-en-1-amine |
| SMILES | C#C.C/C(=N\C=C/CN)N1CCCCC1.CO |
| InChI | InChI=1S/C10H19N3.C2H2.CH4O/c1-10(12-7-5-6-11)13-8-3-2-4-9-13;2*1-2/h5,7H,2-4,6,8-9,11H2,1H3;1-2H;2H,1H3/b7-5-,12-10+;; |
| InChIKey | RDSCQBRLGSYJKG-XXJVPTPISA-N |
| XLogP | 1.22 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|