C13H23N3O — CID 156802218
1-[N-[(1Z,3Z)-3-aminohexa-1,3-dienyl]-C-methylcarbonimidoyl]piperidin-3-ol (PubChem CID 156802218) has the molecular formula C13H23N3O and a molecular weight of 237.35 g/mol. Its IUPAC name is 1-[N-[(1Z,3Z)-3-aminohexa-1,3-dienyl]-C-methylcarbonimidoyl]piperidin-3-ol.
| Compound Name | 1-[N-[(1Z,3Z)-3-aminohexa-1,3-dienyl]-C-methylcarbonimidoyl]piperidin-3-ol |
|---|---|
| PubChem CID | 156802218 |
| Molecular Formula | C13H23N3O |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.18 |
| IUPAC Name | 1-[N-[(1Z,3Z)-3-aminohexa-1,3-dienyl]-C-methylcarbonimidoyl]piperidin-3-ol |
| SMILES | CC/C=C(N)/C=C\N=C(/C)N1CCCC(O)C1 |
| InChI | InChI=1S/C13H23N3O/c1-3-5-12(14)7-8-15-11(2)16-9-4-6-13(17)10-16/h5,7-8,13,17H,3-4,6,9-10,14H2,1-2H3/b8-7-,12-5-,15-11+ |
| InChIKey | ULVWSVUZIGDDDI-RXWXNZOLSA-N |
| XLogP | 1.63 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|