About 1-piperidin-1-ylethanone;propanal
1-piperidin-1-ylethanone;propanal (PubChem CID 178173122) has the molecular formula C10H19NO2
and a molecular weight of 185.27 g/mol. Its IUPAC name is 1-piperidin-1-ylethanone;propanal.
Molecular Properties
| Compound Name | 1-piperidin-1-ylethanone;propanal |
| PubChem CID | 178173122 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | 1-piperidin-1-ylethanone;propanal |
| SMILES | CC(=O)N1CCCCC1.CCC=O |
| InChI | InChI=1S/C7H13NO.C3H6O/c1-7(9)8-5-3-2-4-6-8;1-2-3-4/h2-6H2,1H3;3H,2H2,1H3 |
| InChIKey | FJRYSUOZWWYBDE-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1-piperidin-1-ylethanone;propanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-piperidin-1-ylethanone;propanal?
The IUPAC name of 1-piperidin-1-ylethanone;propanal (CID 178173122) is 1-piperidin-1-ylethanone;propanal.
What is the SMILES notation for 1-piperidin-1-ylethanone;propanal?
The canonical SMILES for 1-piperidin-1-ylethanone;propanal is CC(=O)N1CCCCC1.CCC=O.
What is the InChIKey of 1-piperidin-1-ylethanone;propanal?
The InChIKey is FJRYSUOZWWYBDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO.C3H6O/c1-7(9)8-5-3-2-4-6-8;1-2-3-4/h2-6H2,1H3;3H,2H2,1H3.
What are the key properties of 1-piperidin-1-ylethanone;propanal?
1-piperidin-1-ylethanone;propanal has a molecular weight of 185.27 g/mol, XLogP of 1.61, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-piperidin-1-ylethanone;propanal is sourced from PubChem (CID 178173122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).