About N-ethylethanamine;1-piperidin-1-ylethanone
N-ethylethanamine;1-piperidin-1-ylethanone (PubChem CID 143658502) has the molecular formula C11H24N2O
and a molecular weight of 200.33 g/mol. Its IUPAC name is N-ethylethanamine;1-piperidin-1-ylethanone.
Molecular Properties
| Compound Name | N-ethylethanamine;1-piperidin-1-ylethanone |
| PubChem CID | 143658502 |
| Molecular Formula | C11H24N2O |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.19 |
| IUPAC Name | N-ethylethanamine;1-piperidin-1-ylethanone |
| SMILES | CC(=O)N1CCCCC1.CCNCC |
| InChI | InChI=1S/C7H13NO.C4H11N/c1-7(9)8-5-3-2-4-6-8;1-3-5-4-2/h2-6H2,1H3;5H,3-4H2,1-2H3 |
| InChIKey | JQXSETQONIVLJZ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-ethylethanamine;1-piperidin-1-ylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethylethanamine;1-piperidin-1-ylethanone?
The IUPAC name of N-ethylethanamine;1-piperidin-1-ylethanone (CID 143658502) is N-ethylethanamine;1-piperidin-1-ylethanone.
What is the SMILES notation for N-ethylethanamine;1-piperidin-1-ylethanone?
The canonical SMILES for N-ethylethanamine;1-piperidin-1-ylethanone is CC(=O)N1CCCCC1.CCNCC.
What is the InChIKey of N-ethylethanamine;1-piperidin-1-ylethanone?
The InChIKey is JQXSETQONIVLJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO.C4H11N/c1-7(9)8-5-3-2-4-6-8;1-3-5-4-2/h2-6H2,1H3;5H,3-4H2,1-2H3.
What are the key properties of N-ethylethanamine;1-piperidin-1-ylethanone?
N-ethylethanamine;1-piperidin-1-ylethanone has a molecular weight of 200.33 g/mol, XLogP of 1.63, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethylethanamine;1-piperidin-1-ylethanone is sourced from PubChem (CID 143658502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).