C13H25N3O — CID 103070091
1-[4-[2-(ethylaminomethyl)prop-2-enyl]-1,4-diazepan-1-yl]ethanone (PubChem CID 103070091) has the molecular formula C13H25N3O and a molecular weight of 239.36 g/mol. Its IUPAC name is 1-[4-[2-(ethylaminomethyl)prop-2-enyl]-1,4-diazepan-1-yl]ethanone.
| Compound Name | 1-[4-[2-(ethylaminomethyl)prop-2-enyl]-1,4-diazepan-1-yl]ethanone |
|---|---|
| PubChem CID | 103070091 |
| Molecular Formula | C13H25N3O |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.20 |
| IUPAC Name | 1-[4-[2-(ethylaminomethyl)prop-2-enyl]-1,4-diazepan-1-yl]ethanone |
| SMILES | C=C(CNCC)CN1CCCN(C(C)=O)CC1 |
| InChI | InChI=1S/C13H25N3O/c1-4-14-10-12(2)11-15-6-5-7-16(9-8-15)13(3)17/h14H,2,4-11H2,1,3H3 |
| InChIKey | ZPAUVKSXHCXAFO-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|