C12H25N3 — CID 103070608
2-[(3,4-dimethylpiperazin-1-yl)methyl]-N-ethylprop-2-en-1-amine (PubChem CID 103070608) has the molecular formula C12H25N3 and a molecular weight of 211.35 g/mol. Its IUPAC name is 2-[(3,4-dimethylpiperazin-1-yl)methyl]-N-ethylprop-2-en-1-amine.
| Compound Name | 2-[(3,4-dimethylpiperazin-1-yl)methyl]-N-ethylprop-2-en-1-amine |
|---|---|
| PubChem CID | 103070608 |
| Molecular Formula | C12H25N3 |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.20 |
| IUPAC Name | 2-[(3,4-dimethylpiperazin-1-yl)methyl]-N-ethylprop-2-en-1-amine |
| SMILES | C=C(CNCC)CN1CCN(C)C(C)C1 |
| InChI | InChI=1S/C12H25N3/c1-5-13-8-11(2)9-15-7-6-14(4)12(3)10-15/h12-13H,2,5-10H2,1,3-4H3 |
| InChIKey | IFEVLWXEDYZIPI-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|