C20H32FN — CID 142209262
4-[[4-[(3Z)-2-fluorohepta-1,3,5-trien-4-yl]cyclohexyl]methyl]-1-methylpiperidine (PubChem CID 142209262) has the molecular formula C20H32FN and a molecular weight of 305.48 g/mol. Its IUPAC name is 4-[[4-[(3Z)-2-fluorohepta-1,3,5-trien-4-yl]cyclohexyl]methyl]-1-methylpiperidine.
| Compound Name | 4-[[4-[(3Z)-2-fluorohepta-1,3,5-trien-4-yl]cyclohexyl]methyl]-1-methylpiperidine |
|---|---|
| PubChem CID | 142209262 |
| Molecular Formula | C20H32FN |
| Molecular Weight | 305.48 g/mol |
| Exact Mass | 305.25 |
| IUPAC Name | 4-[[4-[(3Z)-2-fluorohepta-1,3,5-trien-4-yl]cyclohexyl]methyl]-1-methylpiperidine |
| SMILES | C=C(F)/C=C(\C=CC)C1CCC(CC2CCN(C)CC2)CC1 |
| InChI | InChI=1S/C20H32FN/c1-4-5-20(14-16(2)21)19-8-6-17(7-9-19)15-18-10-12-22(3)13-11-18/h4-5,14,17-19H,2,6-13,15H2,1,3H3/b5-4?,20-14+ |
| InChIKey | MDUBVYNRVABEPE-WWZLXFOCSA-N |
| XLogP | 5.51 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.48 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|