C13H22FN — CID 145086092
(3E,5Z)-3-cyclopropyl-4-fluoro-2-methylidenehepta-3,5-dien-1-amine;ethane (PubChem CID 145086092) has the molecular formula C13H22FN and a molecular weight of 211.32 g/mol. Its IUPAC name is (3E,5Z)-3-cyclopropyl-4-fluoro-2-methylidenehepta-3,5-dien-1-amine;ethane.
| Compound Name | (3E,5Z)-3-cyclopropyl-4-fluoro-2-methylidenehepta-3,5-dien-1-amine;ethane |
|---|---|
| PubChem CID | 145086092 |
| Molecular Formula | C13H22FN |
| Molecular Weight | 211.32 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | (3E,5Z)-3-cyclopropyl-4-fluoro-2-methylidenehepta-3,5-dien-1-amine;ethane |
| SMILES | C=C(CN)/C(=C(F)\C=C/C)C1CC1.CC |
| InChI | InChI=1S/C11H16FN.C2H6/c1-3-4-10(12)11(8(2)7-13)9-5-6-9;1-2/h3-4,9H,2,5-7,13H2,1H3;1-2H3/b4-3-,11-10-; |
| InChIKey | RYQUGDHLTBMLFE-VEVJROGOSA-N |
| XLogP | 3.74 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.32 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|