About (3E,5Z)-3-cyclopropyl-4-fluoro-2-methylidenehepta-3,5-dien-1-amine;ethane
(3E,5Z)-3-cyclopropyl-4-fluoro-2-methylidenehepta-3,5-dien-1-amine;ethane (PubChem CID 145086092) has the molecular formula C13H22FN
and a molecular weight of 211.32 g/mol. Its IUPAC name is (3E,5Z)-3-cyclopropyl-4-fluoro-2-methylidenehepta-3,5-dien-1-amine;ethane.
Molecular Properties
| Compound Name | (3E,5Z)-3-cyclopropyl-4-fluoro-2-methylidenehepta-3,5-dien-1-amine;ethane |
| PubChem CID | 145086092 |
| Molecular Formula | C13H22FN |
| Molecular Weight | 211.32 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | (3E,5Z)-3-cyclopropyl-4-fluoro-2-methylidenehepta-3,5-dien-1-amine;ethane |
| SMILES | C=C(CN)/C(=C(F)\C=C/C)C1CC1.CC |
| InChI | InChI=1S/C11H16FN.C2H6/c1-3-4-10(12)11(8(2)7-13)9-5-6-9;1-2/h3-4,9H,2,5-7,13H2,1H3;1-2H3/b4-3-,11-10-; |
| InChIKey | RYQUGDHLTBMLFE-VEVJROGOSA-N |
| XLogP | 3.74 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.32 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3E,5Z)-3-cyclopropyl-4-fluoro-2-methylidenehepta-3,5-dien-1-amine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E,5Z)-3-cyclopropyl-4-fluoro-2-methylidenehepta-3,5-dien-1-amine;ethane?
The IUPAC name of (3E,5Z)-3-cyclopropyl-4-fluoro-2-methylidenehepta-3,5-dien-1-amine;ethane (CID 145086092) is (3E,5Z)-3-cyclopropyl-4-fluoro-2-methylidenehepta-3,5-dien-1-amine;ethane.
What is the SMILES notation for (3E,5Z)-3-cyclopropyl-4-fluoro-2-methylidenehepta-3,5-dien-1-amine;ethane?
The canonical SMILES for (3E,5Z)-3-cyclopropyl-4-fluoro-2-methylidenehepta-3,5-dien-1-amine;ethane is C=C(CN)/C(=C(F)\C=C/C)C1CC1.CC.
What is the InChIKey of (3E,5Z)-3-cyclopropyl-4-fluoro-2-methylidenehepta-3,5-dien-1-amine;ethane?
The InChIKey is RYQUGDHLTBMLFE-VEVJROGOSA-N. The full InChI is InChI=1S/C11H16FN.C2H6/c1-3-4-10(12)11(8(2)7-13)9-5-6-9;1-2/h3-4,9H,2,5-7,13H2,1H3;1-2H3/b4-3-,11-10-;.
What are the key properties of (3E,5Z)-3-cyclopropyl-4-fluoro-2-methylidenehepta-3,5-dien-1-amine;ethane?
(3E,5Z)-3-cyclopropyl-4-fluoro-2-methylidenehepta-3,5-dien-1-amine;ethane has a molecular weight of 211.32 g/mol, XLogP of 3.74, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3E,5Z)-3-cyclopropyl-4-fluoro-2-methylidenehepta-3,5-dien-1-amine;ethane is sourced from PubChem (CID 145086092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).