C10H18FN — CID 130314599
(Z)-3-ethenyl-7-fluoro-4-methylhept-2-en-1-amine (PubChem CID 130314599) has the molecular formula C10H18FN and a molecular weight of 171.26 g/mol. Its IUPAC name is (Z)-3-ethenyl-7-fluoro-4-methylhept-2-en-1-amine.
| Compound Name | (Z)-3-ethenyl-7-fluoro-4-methylhept-2-en-1-amine |
|---|---|
| PubChem CID | 130314599 |
| Molecular Formula | C10H18FN |
| Molecular Weight | 171.26 g/mol |
| Exact Mass | 171.14 |
| IUPAC Name | (Z)-3-ethenyl-7-fluoro-4-methylhept-2-en-1-amine |
| SMILES | C=C/C(=C/CN)C(C)CCCF |
| InChI | InChI=1S/C10H18FN/c1-3-10(6-8-12)9(2)5-4-7-11/h3,6,9H,1,4-5,7-8,12H2,2H3/b10-6- |
| InChIKey | NGEUSXYJVVBUOL-POHAHGRESA-N |
| XLogP | 2.44 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.26 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|