C24H36FN — CID 129267288
(2E,4Z,9Z,11Z)-2-ethenyl-5-(fluoromethyl)-4,8,13-trimethyl-6-methylideneheptadeca-2,4,9,11,16-pentaen-1-amine (PubChem CID 129267288) has the molecular formula C24H36FN and a molecular weight of 357.56 g/mol. Its IUPAC name is (2E,4Z,9Z,11Z)-2-ethenyl-5-(fluoromethyl)-4,8,13-trimethyl-6-methylideneheptadeca-2,4,9,11,16-pentaen-1-amine.
| Compound Name | (2E,4Z,9Z,11Z)-2-ethenyl-5-(fluoromethyl)-4,8,13-trimethyl-6-methylideneheptadeca-2,4,9,11,16-pentaen-1-amine |
|---|---|
| PubChem CID | 129267288 |
| Molecular Formula | C24H36FN |
| Molecular Weight | 357.56 g/mol |
| Exact Mass | 357.28 |
| IUPAC Name | (2E,4Z,9Z,11Z)-2-ethenyl-5-(fluoromethyl)-4,8,13-trimethyl-6-methylideneheptadeca-2,4,9,11,16-pentaen-1-amine |
| SMILES | C=CCCC(C)/C=C\C=C/C(C)CC(=C)/C(CF)=C(C)/C=C(\C=C)CN |
| InChI | InChI=1S/C24H36FN/c1-7-9-12-19(3)13-10-11-14-20(4)15-21(5)24(17-25)22(6)16-23(8-2)18-26/h7-8,10-11,13-14,16,19-20H,1-2,5,9,12,15,17-18,26H2,3-4,6H3/b13-10-,14-11-,23-16+,24-22+ |
| InChIKey | XNGNIEXPWVVFFV-SWJCOZNDSA-N |
| XLogP | 6.64 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.56 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|