C15H22F3N — CID 131981650
[4-[(E)-hept-3-enyl]-5-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]methanamine (PubChem CID 131981650) has the molecular formula C15H22F3N and a molecular weight of 273.34 g/mol. Its IUPAC name is [4-[(E)-hept-3-enyl]-5-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]methanamine.
| Compound Name | [4-[(E)-hept-3-enyl]-5-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]methanamine |
|---|---|
| PubChem CID | 131981650 |
| Molecular Formula | C15H22F3N |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | [4-[(E)-hept-3-enyl]-5-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]methanamine |
| SMILES | CCC/C=C/CCC1CC=C(CN)C=C1C(F)(F)F |
| InChI | InChI=1S/C15H22F3N/c1-2-3-4-5-6-7-13-9-8-12(11-19)10-14(13)15(16,17)18/h4-5,8,10,13H,2-3,6-7,9,11,19H2,1H3/b5-4+ |
| InChIKey | JDPYTKTXYNNKTR-SNAWJCMRSA-N |
| XLogP | 4.52 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|