C11H18F3N — CID 131999217
(1E,3Z)-3-propan-2-yl-2-(trifluoromethyl)hepta-1,3-dien-1-amine (PubChem CID 131999217) has the molecular formula C11H18F3N and a molecular weight of 221.27 g/mol. Its IUPAC name is (1E,3Z)-3-propan-2-yl-2-(trifluoromethyl)hepta-1,3-dien-1-amine.
| Compound Name | (1E,3Z)-3-propan-2-yl-2-(trifluoromethyl)hepta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 131999217 |
| Molecular Formula | C11H18F3N |
| Molecular Weight | 221.27 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | (1E,3Z)-3-propan-2-yl-2-(trifluoromethyl)hepta-1,3-dien-1-amine |
| SMILES | CCC/C=C(C(=C/N)\C(F)(F)F)/C(C)C |
| InChI | InChI=1S/C11H18F3N/c1-4-5-6-9(8(2)3)10(7-15)11(12,13)14/h6-8H,4-5,15H2,1-3H3/b9-6-,10-7+ |
| InChIKey | RHIZQPITXMVIGL-PCCLLEMOSA-N |
| XLogP | 3.77 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.27 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|