About (5-fluoro-3-methylcyclohepta-1,6-dien-1-yl)methanamine
(5-fluoro-3-methylcyclohepta-1,6-dien-1-yl)methanamine (PubChem CID 91099450) has the molecular formula C9H14FN
and a molecular weight of 155.22 g/mol. Its IUPAC name is (5-fluoro-3-methylcyclohepta-1,6-dien-1-yl)methanamine.
Analyze (5-fluoro-3-methylcyclohepta-1,6-dien-1-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-fluoro-3-methylcyclohepta-1,6-dien-1-yl)methanamine?
The IUPAC name of (5-fluoro-3-methylcyclohepta-1,6-dien-1-yl)methanamine (CID 91099450) is (5-fluoro-3-methylcyclohepta-1,6-dien-1-yl)methanamine.
What is the SMILES notation for (5-fluoro-3-methylcyclohepta-1,6-dien-1-yl)methanamine?
The canonical SMILES for (5-fluoro-3-methylcyclohepta-1,6-dien-1-yl)methanamine is CC1C=C(CN)C=CC(F)C1.
What is the InChIKey of (5-fluoro-3-methylcyclohepta-1,6-dien-1-yl)methanamine?
The InChIKey is LASIAMKYTJTHCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14FN/c1-7-4-8(6-11)2-3-9(10)5-7/h2-4,7,9H,5-6,11H2,1H3.
What are the key properties of (5-fluoro-3-methylcyclohepta-1,6-dien-1-yl)methanamine?
(5-fluoro-3-methylcyclohepta-1,6-dien-1-yl)methanamine has a molecular weight of 155.22 g/mol, XLogP of 1.81, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5-fluoro-3-methylcyclohepta-1,6-dien-1-yl)methanamine is sourced from PubChem (CID 91099450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).