C16H25F2N — CID 130286458
(5E,7Z,9Z)-7-[3-fluoro-2-(fluoromethyl)propyl]-2-methylundeca-1,5,7,9-tetraen-4-amine (PubChem CID 130286458) has the molecular formula C16H25F2N and a molecular weight of 269.38 g/mol. Its IUPAC name is (5E,7Z,9Z)-7-[3-fluoro-2-(fluoromethyl)propyl]-2-methylundeca-1,5,7,9-tetraen-4-amine.
| Compound Name | (5E,7Z,9Z)-7-[3-fluoro-2-(fluoromethyl)propyl]-2-methylundeca-1,5,7,9-tetraen-4-amine |
|---|---|
| PubChem CID | 130286458 |
| Molecular Formula | C16H25F2N |
| Molecular Weight | 269.38 g/mol |
| Exact Mass | 269.20 |
| IUPAC Name | (5E,7Z,9Z)-7-[3-fluoro-2-(fluoromethyl)propyl]-2-methylundeca-1,5,7,9-tetraen-4-amine |
| SMILES | C=C(C)CC(N)/C=C/C(=C\C=C/C)CC(CF)CF |
| InChI | InChI=1S/C16H25F2N/c1-4-5-6-14(10-15(11-17)12-18)7-8-16(19)9-13(2)3/h4-8,15-16H,2,9-12,19H2,1,3H3/b5-4-,8-7+,14-6+ |
| InChIKey | FJIPVJFXTNMINU-XTWBODQRSA-N |
| XLogP | 4.28 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.38 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|