C23H40FN — CID 89090365
(4E,10E,12E)-15-fluoro-2,4,6,8,10,16-hexamethylheptadeca-2,4,10,12-tetraen-7-amine (PubChem CID 89090365) has the molecular formula C23H40FN and a molecular weight of 349.58 g/mol. Its IUPAC name is (4E,10E,12E)-15-fluoro-2,4,6,8,10,16-hexamethylheptadeca-2,4,10,12-tetraen-7-amine.
| Compound Name | (4E,10E,12E)-15-fluoro-2,4,6,8,10,16-hexamethylheptadeca-2,4,10,12-tetraen-7-amine |
|---|---|
| PubChem CID | 89090365 |
| Molecular Formula | C23H40FN |
| Molecular Weight | 349.58 g/mol |
| Exact Mass | 349.31 |
| IUPAC Name | (4E,10E,12E)-15-fluoro-2,4,6,8,10,16-hexamethylheptadeca-2,4,10,12-tetraen-7-amine |
| SMILES | CC(C)=C/C(C)=C/C(C)C(N)C(C)C/C(C)=C/C=C/CC(F)C(C)C |
| InChI | InChI=1S/C23H40FN/c1-16(2)13-19(6)15-21(8)23(25)20(7)14-18(5)11-9-10-12-22(24)17(3)4/h9-11,13,15,17,20-23H,12,14,25H2,1-8H3/b10-9+,18-11+,19-15+ |
| InChIKey | KVEXICFLHHWMDI-NQVCMDRWSA-N |
| XLogP | 6.78 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.58 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|