C20H34FN — CID 90898692
6-[2-(2-ethyl-2-fluoro-3-methylbutyl)cyclopropyl]-3-ethylideneocta-4,6-dien-2-amine (PubChem CID 90898692) has the molecular formula C20H34FN and a molecular weight of 307.50 g/mol. Its IUPAC name is 6-[2-(2-ethyl-2-fluoro-3-methylbutyl)cyclopropyl]-3-ethylideneocta-4,6-dien-2-amine.
| Compound Name | 6-[2-(2-ethyl-2-fluoro-3-methylbutyl)cyclopropyl]-3-ethylideneocta-4,6-dien-2-amine |
|---|---|
| PubChem CID | 90898692 |
| Molecular Formula | C20H34FN |
| Molecular Weight | 307.50 g/mol |
| Exact Mass | 307.27 |
| IUPAC Name | 6-[2-(2-ethyl-2-fluoro-3-methylbutyl)cyclopropyl]-3-ethylideneocta-4,6-dien-2-amine |
| SMILES | CC=C(C=CC(=CC)C1CC1CC(F)(CC)C(C)C)C(C)N |
| InChI | InChI=1S/C20H34FN/c1-7-16(15(6)22)10-11-17(8-2)19-12-18(19)13-20(21,9-3)14(4)5/h7-8,10-11,14-15,18-19H,9,12-13,22H2,1-6H3 |
| InChIKey | UCDQBOVNAIUXLA-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.50 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|