C13H24N2 — CID 145309756
4-methyl-2-[(3E)-penta-1,3-dien-3-yl]-1-propan-2-ylpiperazine (PubChem CID 145309756) has the molecular formula C13H24N2 and a molecular weight of 208.35 g/mol. Its IUPAC name is 4-methyl-2-[(3E)-penta-1,3-dien-3-yl]-1-propan-2-ylpiperazine.
| Compound Name | 4-methyl-2-[(3E)-penta-1,3-dien-3-yl]-1-propan-2-ylpiperazine |
|---|---|
| PubChem CID | 145309756 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | 4-methyl-2-[(3E)-penta-1,3-dien-3-yl]-1-propan-2-ylpiperazine |
| SMILES | C=C/C(=C\C)C1CN(C)CCN1C(C)C |
| InChI | InChI=1S/C13H24N2/c1-6-12(7-2)13-10-14(5)8-9-15(13)11(3)4/h6-7,11,13H,1,8-10H2,2-5H3/b12-7+ |
| InChIKey | LLMJPYSGYSWKOF-KPKJPENVSA-N |
| XLogP | 2.14 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|