C10H20N2O2 — CID 135240223
methyl 2-[(2R)-2,4-dimethylpiperazin-1-yl]propanoate (PubChem CID 135240223) has the molecular formula C10H20N2O2 and a molecular weight of 200.28 g/mol. Its IUPAC name is methyl 2-[(2R)-2,4-dimethylpiperazin-1-yl]propanoate.
| Compound Name | methyl 2-[(2R)-2,4-dimethylpiperazin-1-yl]propanoate |
|---|---|
| PubChem CID | 135240223 |
| Molecular Formula | C10H20N2O2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.15 |
| IUPAC Name | methyl 2-[(2R)-2,4-dimethylpiperazin-1-yl]propanoate |
| SMILES | COC(=O)C(C)N1CCN(C)C[C@H]1C |
| InChI | InChI=1S/C10H20N2O2/c1-8-7-11(3)5-6-12(8)9(2)10(13)14-4/h8-9H,5-7H2,1-4H3/t8-,9?/m1/s1 |
| InChIKey | OVEVPPGNENEXDJ-VEDVMXKPSA-N |
| XLogP | 0.18 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |