C10H19NO2S — CID 115648490
methyl 2-(2,3-dimethylthiomorpholin-4-yl)propanoate (PubChem CID 115648490) has the molecular formula C10H19NO2S and a molecular weight of 217.33 g/mol. Its IUPAC name is methyl 2-(2,3-dimethylthiomorpholin-4-yl)propanoate.
| Compound Name | methyl 2-(2,3-dimethylthiomorpholin-4-yl)propanoate |
|---|---|
| PubChem CID | 115648490 |
| Molecular Formula | C10H19NO2S |
| Molecular Weight | 217.33 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | methyl 2-(2,3-dimethylthiomorpholin-4-yl)propanoate |
| SMILES | COC(=O)C(C)N1CCSC(C)C1C |
| InChI | InChI=1S/C10H19NO2S/c1-7-9(3)14-6-5-11(7)8(2)10(12)13-4/h7-9H,5-6H2,1-4H3 |
| InChIKey | GXOFSDBNGHFYKW-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.33 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |