C11H22N2OS — CID 115634669
N,N-diethyl-2,3-dimethylthiomorpholine-4-carboxamide (PubChem CID 115634669) has the molecular formula C11H22N2OS and a molecular weight of 230.38 g/mol. Its IUPAC name is N,N-diethyl-2,3-dimethylthiomorpholine-4-carboxamide.
| Compound Name | N,N-diethyl-2,3-dimethylthiomorpholine-4-carboxamide |
|---|---|
| PubChem CID | 115634669 |
| Molecular Formula | C11H22N2OS |
| Molecular Weight | 230.38 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | N,N-diethyl-2,3-dimethylthiomorpholine-4-carboxamide |
| SMILES | CCN(CC)C(=O)N1CCSC(C)C1C |
| InChI | InChI=1S/C11H22N2OS/c1-5-12(6-2)11(14)13-7-8-15-10(4)9(13)3/h9-10H,5-8H2,1-4H3 |
| InChIKey | CTOQSEKYDNRHSK-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.38 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |