C10H19NO2S — CID 115634385
1-(2,3-dimethylthiomorpholin-4-yl)-2-ethoxyethanone (PubChem CID 115634385) has the molecular formula C10H19NO2S and a molecular weight of 217.33 g/mol. Its IUPAC name is 1-(2,3-dimethylthiomorpholin-4-yl)-2-ethoxyethanone.
| Compound Name | 1-(2,3-dimethylthiomorpholin-4-yl)-2-ethoxyethanone |
|---|---|
| PubChem CID | 115634385 |
| Molecular Formula | C10H19NO2S |
| Molecular Weight | 217.33 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | 1-(2,3-dimethylthiomorpholin-4-yl)-2-ethoxyethanone |
| SMILES | CCOCC(=O)N1CCSC(C)C1C |
| InChI | InChI=1S/C10H19NO2S/c1-4-13-7-10(12)11-5-6-14-9(3)8(11)2/h8-9H,4-7H2,1-3H3 |
| InChIKey | HTPQAWVXNPXTFB-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.33 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |