C12H20O3S2 — CID 115388384
methyl 3-methyl-2-(3-methyl-1,4-dithiane-2-carbonyl)butanoate (PubChem CID 115388384) has the molecular formula C12H20O3S2 and a molecular weight of 276.42 g/mol. Its IUPAC name is methyl 3-methyl-2-(3-methyl-1,4-dithiane-2-carbonyl)butanoate.
| Compound Name | methyl 3-methyl-2-(3-methyl-1,4-dithiane-2-carbonyl)butanoate |
|---|---|
| PubChem CID | 115388384 |
| Molecular Formula | C12H20O3S2 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | methyl 3-methyl-2-(3-methyl-1,4-dithiane-2-carbonyl)butanoate |
| SMILES | COC(=O)C(C(=O)C1SCCSC1C)C(C)C |
| InChI | InChI=1S/C12H20O3S2/c1-7(2)9(12(14)15-4)10(13)11-8(3)16-5-6-17-11/h7-9,11H,5-6H2,1-4H3 |
| InChIKey | WWLVRHJPXPSCBY-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|