C10H22N2O — CID 174323904
1-(1-ethoxyethyl)-2,4-dimethylpiperazine (PubChem CID 174323904) has the molecular formula C10H22N2O and a molecular weight of 186.30 g/mol. Its IUPAC name is 1-(1-ethoxyethyl)-2,4-dimethylpiperazine.
| Compound Name | 1-(1-ethoxyethyl)-2,4-dimethylpiperazine |
|---|---|
| PubChem CID | 174323904 |
| Molecular Formula | C10H22N2O |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.17 |
| IUPAC Name | 1-(1-ethoxyethyl)-2,4-dimethylpiperazine |
| SMILES | CCOC(C)N1CCN(C)CC1C |
| InChI | InChI=1S/C10H22N2O/c1-5-13-10(3)12-7-6-11(4)8-9(12)2/h9-10H,5-8H2,1-4H3 |
| InChIKey | KBMLOHBCFXCVIU-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |