C11H24N2 — CID 58964341
4-methyl-1,2-di(propan-2-yl)piperazine (PubChem CID 58964341) has the molecular formula C11H24N2 and a molecular weight of 184.33 g/mol. Its IUPAC name is 4-methyl-1,2-di(propan-2-yl)piperazine.
| Compound Name | 4-methyl-1,2-di(propan-2-yl)piperazine |
|---|---|
| PubChem CID | 58964341 |
| Molecular Formula | C11H24N2 |
| Molecular Weight | 184.33 g/mol |
| Exact Mass | 184.19 |
| IUPAC Name | 4-methyl-1,2-di(propan-2-yl)piperazine |
| SMILES | CC(C)C1CN(C)CCN1C(C)C |
| InChI | InChI=1S/C11H24N2/c1-9(2)11-8-12(5)6-7-13(11)10(3)4/h9-11H,6-8H2,1-5H3 |
| InChIKey | WWJZIIXXPZBYFC-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.33 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |