C13H27N — CID 134605032
1,2-di(propan-2-yl)azocane (PubChem CID 134605032) has the molecular formula C13H27N and a molecular weight of 197.37 g/mol. Its IUPAC name is 1,2-di(propan-2-yl)azocane.
| Compound Name | 1,2-di(propan-2-yl)azocane |
|---|---|
| PubChem CID | 134605032 |
| Molecular Formula | C13H27N |
| Molecular Weight | 197.37 g/mol |
| Exact Mass | 197.21 |
| IUPAC Name | 1,2-di(propan-2-yl)azocane |
| SMILES | CC(C)C1CCCCCCN1C(C)C |
| InChI | InChI=1S/C13H27N/c1-11(2)13-9-7-5-6-8-10-14(13)12(3)4/h11-13H,5-10H2,1-4H3 |
| InChIKey | LIDZWYXYUOSAEQ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.37 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |