About (7R)-N,1,7-tri(propan-2-yl)azepan-4-amine
(7R)-N,1,7-tri(propan-2-yl)azepan-4-amine (PubChem CID 152916334) has the molecular formula C15H32N2
and a molecular weight of 240.44 g/mol. Its IUPAC name is (7R)-N,1,7-tri(propan-2-yl)azepan-4-amine.
Molecular Properties
| Compound Name | (7R)-N,1,7-tri(propan-2-yl)azepan-4-amine |
| PubChem CID | 152916334 |
| Molecular Formula | C15H32N2 |
| Molecular Weight | 240.44 g/mol |
| Exact Mass | 240.26 |
| IUPAC Name | (7R)-N,1,7-tri(propan-2-yl)azepan-4-amine |
| SMILES | CC(C)NC1CC[C@H](C(C)C)N(C(C)C)CC1 |
| InChI | InChI=1S/C15H32N2/c1-11(2)15-8-7-14(16-12(3)4)9-10-17(15)13(5)6/h11-16H,7-10H2,1-6H3/t14?,15-/m1/s1 |
| InChIKey | UIFCHBQOWLBAAM-YSSOQSIOSA-N |
| XLogP | 3.27 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.44 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (7R)-N,1,7-tri(propan-2-yl)azepan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7R)-N,1,7-tri(propan-2-yl)azepan-4-amine?
The IUPAC name of (7R)-N,1,7-tri(propan-2-yl)azepan-4-amine (CID 152916334) is (7R)-N,1,7-tri(propan-2-yl)azepan-4-amine.
What is the SMILES notation for (7R)-N,1,7-tri(propan-2-yl)azepan-4-amine?
The canonical SMILES for (7R)-N,1,7-tri(propan-2-yl)azepan-4-amine is CC(C)NC1CC[C@H](C(C)C)N(C(C)C)CC1.
What is the InChIKey of (7R)-N,1,7-tri(propan-2-yl)azepan-4-amine?
The InChIKey is UIFCHBQOWLBAAM-YSSOQSIOSA-N. The full InChI is InChI=1S/C15H32N2/c1-11(2)15-8-7-14(16-12(3)4)9-10-17(15)13(5)6/h11-16H,7-10H2,1-6H3/t14?,15-/m1/s1.
What are the key properties of (7R)-N,1,7-tri(propan-2-yl)azepan-4-amine?
(7R)-N,1,7-tri(propan-2-yl)azepan-4-amine has a molecular weight of 240.44 g/mol, XLogP of 3.27, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (7R)-N,1,7-tri(propan-2-yl)azepan-4-amine is sourced from PubChem (CID 152916334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).