About (7R)-7-tert-butyl-N,1-di(propan-2-yl)azepan-4-amine
(7R)-7-tert-butyl-N,1-di(propan-2-yl)azepan-4-amine (PubChem CID 153291257) has the molecular formula C16H34N2
and a molecular weight of 254.46 g/mol. Its IUPAC name is (7R)-7-tert-butyl-N,1-di(propan-2-yl)azepan-4-amine.
Molecular Properties
| Compound Name | (7R)-7-tert-butyl-N,1-di(propan-2-yl)azepan-4-amine |
| PubChem CID | 153291257 |
| Molecular Formula | C16H34N2 |
| Molecular Weight | 254.46 g/mol |
| Exact Mass | 254.27 |
| IUPAC Name | (7R)-7-tert-butyl-N,1-di(propan-2-yl)azepan-4-amine |
| SMILES | CC(C)NC1CC[C@H](C(C)(C)C)N(C(C)C)CC1 |
| InChI | InChI=1S/C16H34N2/c1-12(2)17-14-8-9-15(16(5,6)7)18(11-10-14)13(3)4/h12-15,17H,8-11H2,1-7H3/t14?,15-/m1/s1 |
| InChIKey | VLXRTLWXWDFTIS-YSSOQSIOSA-N |
| XLogP | 3.66 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.46 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (7R)-7-tert-butyl-N,1-di(propan-2-yl)azepan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7R)-7-tert-butyl-N,1-di(propan-2-yl)azepan-4-amine?
The IUPAC name of (7R)-7-tert-butyl-N,1-di(propan-2-yl)azepan-4-amine (CID 153291257) is (7R)-7-tert-butyl-N,1-di(propan-2-yl)azepan-4-amine.
What is the SMILES notation for (7R)-7-tert-butyl-N,1-di(propan-2-yl)azepan-4-amine?
The canonical SMILES for (7R)-7-tert-butyl-N,1-di(propan-2-yl)azepan-4-amine is CC(C)NC1CC[C@H](C(C)(C)C)N(C(C)C)CC1.
What is the InChIKey of (7R)-7-tert-butyl-N,1-di(propan-2-yl)azepan-4-amine?
The InChIKey is VLXRTLWXWDFTIS-YSSOQSIOSA-N. The full InChI is InChI=1S/C16H34N2/c1-12(2)17-14-8-9-15(16(5,6)7)18(11-10-14)13(3)4/h12-15,17H,8-11H2,1-7H3/t14?,15-/m1/s1.
What are the key properties of (7R)-7-tert-butyl-N,1-di(propan-2-yl)azepan-4-amine?
(7R)-7-tert-butyl-N,1-di(propan-2-yl)azepan-4-amine has a molecular weight of 254.46 g/mol, XLogP of 3.66, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (7R)-7-tert-butyl-N,1-di(propan-2-yl)azepan-4-amine is sourced from PubChem (CID 153291257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).