C15H31N — CID 176801550
1,2,5-tri(propan-2-yl)azepane (PubChem CID 176801550) has the molecular formula C15H31N and a molecular weight of 225.42 g/mol. Its IUPAC name is 1,2,5-tri(propan-2-yl)azepane.
| Compound Name | 1,2,5-tri(propan-2-yl)azepane |
|---|---|
| PubChem CID | 176801550 |
| Molecular Formula | C15H31N |
| Molecular Weight | 225.42 g/mol |
| Exact Mass | 225.25 |
| IUPAC Name | 1,2,5-tri(propan-2-yl)azepane |
| SMILES | CC(C)C1CCC(C(C)C)N(C(C)C)CC1 |
| InChI | InChI=1S/C15H31N/c1-11(2)14-7-8-15(12(3)4)16(10-9-14)13(5)6/h11-15H,7-10H2,1-6H3 |
| InChIKey | WTHAZGSPCXRVRB-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.42 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |