C14H27N — CID 174295504
(2R,4S)-2-cyclopropyl-1,4-di(propan-2-yl)piperidine (PubChem CID 174295504) has the molecular formula C14H27N and a molecular weight of 209.38 g/mol. Its IUPAC name is (2R,4S)-2-cyclopropyl-1,4-di(propan-2-yl)piperidine.
| Compound Name | (2R,4S)-2-cyclopropyl-1,4-di(propan-2-yl)piperidine |
|---|---|
| PubChem CID | 174295504 |
| Molecular Formula | C14H27N |
| Molecular Weight | 209.38 g/mol |
| Exact Mass | 209.21 |
| IUPAC Name | (2R,4S)-2-cyclopropyl-1,4-di(propan-2-yl)piperidine |
| SMILES | CC(C)[C@H]1CCN(C(C)C)[C@@H](C2CC2)C1 |
| InChI | InChI=1S/C14H27N/c1-10(2)13-7-8-15(11(3)4)14(9-13)12-5-6-12/h10-14H,5-9H2,1-4H3/t13-,14+/m0/s1 |
| InChIKey | FKZBVEOKKBXQQB-UONOGXRCSA-N |
| XLogP | 3.54 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.38 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |