About ethane;1-methylpyrrolidine;2-propan-2-yl-2-azabicyclo[3.1.0]hexane
ethane;1-methylpyrrolidine;2-propan-2-yl-2-azabicyclo[3.1.0]hexane (PubChem CID 176657759) has the molecular formula C17H38N2
and a molecular weight of 270.50 g/mol. Its IUPAC name is ethane;1-methylpyrrolidine;2-propan-2-yl-2-azabicyclo[3.1.0]hexane.
Molecular Properties
| Compound Name | ethane;1-methylpyrrolidine;2-propan-2-yl-2-azabicyclo[3.1.0]hexane |
| PubChem CID | 176657759 |
| Molecular Formula | C17H38N2 |
| Molecular Weight | 270.50 g/mol |
| Exact Mass | 270.30 |
| IUPAC Name | ethane;1-methylpyrrolidine;2-propan-2-yl-2-azabicyclo[3.1.0]hexane |
| SMILES | CC.CC.CC(C)N1CCC2CC21.CN1CCCC1 |
| InChI | InChI=1S/C8H15N.C5H11N.2C2H6/c1-6(2)9-4-3-7-5-8(7)9;1-6-4-2-3-5-6;2*1-2/h6-8H,3-5H2,1-2H3;2-5H2,1H3;2*1-2H3 |
| InChIKey | IANVOVAQKPRKFT-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.50 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;1-methylpyrrolidine;2-propan-2-yl-2-azabicyclo[3.1.0]hexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-methylpyrrolidine;2-propan-2-yl-2-azabicyclo[3.1.0]hexane?
The IUPAC name of ethane;1-methylpyrrolidine;2-propan-2-yl-2-azabicyclo[3.1.0]hexane (CID 176657759) is ethane;1-methylpyrrolidine;2-propan-2-yl-2-azabicyclo[3.1.0]hexane.
What is the SMILES notation for ethane;1-methylpyrrolidine;2-propan-2-yl-2-azabicyclo[3.1.0]hexane?
The canonical SMILES for ethane;1-methylpyrrolidine;2-propan-2-yl-2-azabicyclo[3.1.0]hexane is CC.CC.CC(C)N1CCC2CC21.CN1CCCC1.
What is the InChIKey of ethane;1-methylpyrrolidine;2-propan-2-yl-2-azabicyclo[3.1.0]hexane?
The InChIKey is IANVOVAQKPRKFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N.C5H11N.2C2H6/c1-6(2)9-4-3-7-5-8(7)9;1-6-4-2-3-5-6;2*1-2/h6-8H,3-5H2,1-2H3;2-5H2,1H3;2*1-2H3.
What are the key properties of ethane;1-methylpyrrolidine;2-propan-2-yl-2-azabicyclo[3.1.0]hexane?
ethane;1-methylpyrrolidine;2-propan-2-yl-2-azabicyclo[3.1.0]hexane has a molecular weight of 270.50 g/mol, XLogP of 4.25, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-methylpyrrolidine;2-propan-2-yl-2-azabicyclo[3.1.0]hexane is sourced from PubChem (CID 176657759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).