C13H26N2 — CID 170939617
5-tert-butyl-1-propan-2-yl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole (PubChem CID 170939617) has the molecular formula C13H26N2 and a molecular weight of 210.37 g/mol. Its IUPAC name is 5-tert-butyl-1-propan-2-yl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole.
| Compound Name | 5-tert-butyl-1-propan-2-yl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole |
|---|---|
| PubChem CID | 170939617 |
| Molecular Formula | C13H26N2 |
| Molecular Weight | 210.37 g/mol |
| Exact Mass | 210.21 |
| IUPAC Name | 5-tert-butyl-1-propan-2-yl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole |
| SMILES | CC(C)N1CCC2CN(C(C)(C)C)CC21 |
| InChI | InChI=1S/C13H26N2/c1-10(2)15-7-6-11-8-14(9-12(11)15)13(3,4)5/h10-12H,6-9H2,1-5H3 |
| InChIKey | LGNSQYHXMYKHMS-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.37 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |