C13H26FN — CID 171506116
(2S)-2-(2-fluoroethyl)-1,4-di(propan-2-yl)piperidine (PubChem CID 171506116) has the molecular formula C13H26FN and a molecular weight of 215.36 g/mol. Its IUPAC name is (2S)-2-(2-fluoroethyl)-1,4-di(propan-2-yl)piperidine.
| Compound Name | (2S)-2-(2-fluoroethyl)-1,4-di(propan-2-yl)piperidine |
|---|---|
| PubChem CID | 171506116 |
| Molecular Formula | C13H26FN |
| Molecular Weight | 215.36 g/mol |
| Exact Mass | 215.20 |
| IUPAC Name | (2S)-2-(2-fluoroethyl)-1,4-di(propan-2-yl)piperidine |
| SMILES | CC(C)C1CCN(C(C)C)[C@H](CCF)C1 |
| InChI | InChI=1S/C13H26FN/c1-10(2)12-6-8-15(11(3)4)13(9-12)5-7-14/h10-13H,5-9H2,1-4H3/t12?,13-/m1/s1 |
| InChIKey | FZRXNHOSRGAUPF-ZGTCLIOFSA-N |
| XLogP | 3.49 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.36 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |