C23H32N2 — CID 176877498
(2R)-4-benzhydryl-1,2-di(propan-2-yl)piperazine (PubChem CID 176877498) has the molecular formula C23H32N2 and a molecular weight of 336.52 g/mol. Its IUPAC name is (2R)-4-benzhydryl-1,2-di(propan-2-yl)piperazine.
| Compound Name | (2R)-4-benzhydryl-1,2-di(propan-2-yl)piperazine |
|---|---|
| PubChem CID | 176877498 |
| Molecular Formula | C23H32N2 |
| Molecular Weight | 336.52 g/mol |
| Exact Mass | 336.26 |
| IUPAC Name | (2R)-4-benzhydryl-1,2-di(propan-2-yl)piperazine |
| SMILES | CC(C)[C@@H]1CN(C(c2ccccc2)c2ccccc2)CCN1C(C)C |
| InChI | InChI=1S/C23H32N2/c1-18(2)22-17-24(15-16-25(22)19(3)4)23(20-11-7-5-8-12-20)21-13-9-6-10-14-21/h5-14,18-19,22-23H,15-17H2,1-4H3/t22-/m0/s1 |
| InChIKey | YNEKTSATEBHEGI-QFIPXVFZSA-N |
| XLogP | 4.83 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.52 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |